C16H14Cl2O4 — CID 16768705
3-(3,4-dichlorophenyl)-4-ethoxy-5-methoxybenzoic acid (PubChem CID 16768705) has the molecular formula C16H14Cl2O4 and a molecular weight of 341.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-4-ethoxy-5-methoxybenzoic acid.
| Compound Name | 3-(3,4-dichlorophenyl)-4-ethoxy-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 16768705 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-4-ethoxy-5-methoxybenzoic acid |
| SMILES | CCOc1c(OC)cc(C(=O)O)cc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O4/c1-3-22-15-11(9-4-5-12(17)13(18)7-9)6-10(16(19)20)8-14(15)21-2/h4-8H,3H2,1-2H3,(H,19,20) |
| InChIKey | GPNXAHNZGFLMRW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |