C10H9ClO6 — CID 117053258
3-chloro-4-(2-hydroxyacetyl)oxy-5-methoxybenzoic acid (PubChem CID 117053258) has the molecular formula C10H9ClO6 and a molecular weight of 260.63 g/mol. Its IUPAC name is 3-chloro-4-(2-hydroxyacetyl)oxy-5-methoxybenzoic acid.
| Compound Name | 3-chloro-4-(2-hydroxyacetyl)oxy-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 117053258 |
| Molecular Formula | C10H9ClO6 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 3-chloro-4-(2-hydroxyacetyl)oxy-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(Cl)c1OC(=O)CO |
| InChI | InChI=1S/C10H9ClO6/c1-16-7-3-5(10(14)15)2-6(11)9(7)17-8(13)4-12/h2-3,12H,4H2,1H3,(H,14,15) |
| InChIKey | PIIQQMUZVSPLQT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|