C13H16ClNO6 — CID 61487582
3-chloro-5-methoxy-4-[2-(2-methoxyethylamino)-2-oxoethoxy]benzoic acid (PubChem CID 61487582) has the molecular formula C13H16ClNO6 and a molecular weight of 317.73 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4-[2-(2-methoxyethylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 3-chloro-5-methoxy-4-[2-(2-methoxyethylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 61487582 |
| Molecular Formula | C13H16ClNO6 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-chloro-5-methoxy-4-[2-(2-methoxyethylamino)-2-oxoethoxy]benzoic acid |
| SMILES | COCCNC(=O)COc1c(Cl)cc(C(=O)O)cc1OC |
| InChI | InChI=1S/C13H16ClNO6/c1-19-4-3-15-11(16)7-21-12-9(14)5-8(13(17)18)6-10(12)20-2/h5-6H,3-4,7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | VZKKBXWAAKCADI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|