C14H21ClN2O4 — CID 61486427
2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-(3-methoxypropyl)acetamide (PubChem CID 61486427) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 61486427 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)COc1c(Cl)cc(CN)cc1OC |
| InChI | InChI=1S/C14H21ClN2O4/c1-19-5-3-4-17-13(18)9-21-14-11(15)6-10(8-16)7-12(14)20-2/h6-7H,3-5,8-9,16H2,1-2H3,(H,17,18) |
| InChIKey | QSNJPXIZFVLQCR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|