C11H14ClN3O4 — CID 28966876
2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-carbamoylacetamide (PubChem CID 28966876) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-carbamoylacetamide.
| Compound Name | 2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 28966876 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-N-carbamoylacetamide |
| SMILES | COc1cc(CN)cc(Cl)c1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C11H14ClN3O4/c1-18-8-3-6(4-13)2-7(12)10(8)19-5-9(16)15-11(14)17/h2-3H,4-5,13H2,1H3,(H3,14,15,16,17) |
| InChIKey | PHKAWUQRERWWIT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |