C9H9Cl2N3O3 — CID 43169631
2-(4-amino-2,6-dichlorophenoxy)-N-carbamoylacetamide (PubChem CID 43169631) has the molecular formula C9H9Cl2N3O3 and a molecular weight of 278.10 g/mol. Its IUPAC name is 2-(4-amino-2,6-dichlorophenoxy)-N-carbamoylacetamide.
| Compound Name | 2-(4-amino-2,6-dichlorophenoxy)-N-carbamoylacetamide |
|---|---|
| PubChem CID | 43169631 |
| Molecular Formula | C9H9Cl2N3O3 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 2-(4-amino-2,6-dichlorophenoxy)-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)COc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O3/c10-5-1-4(12)2-6(11)8(5)17-3-7(15)14-9(13)16/h1-2H,3,12H2,(H3,13,14,15,16) |
| InChIKey | AVRAKASXKCPXFW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|