C13H18Cl2N2O2 — CID 61486362
2-(4-amino-2,6-dichlorophenoxy)-N-(2-methylbutan-2-yl)acetamide (PubChem CID 61486362) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-(4-amino-2,6-dichlorophenoxy)-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-(4-amino-2,6-dichlorophenoxy)-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 61486362 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(4-amino-2,6-dichlorophenoxy)-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)COc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-4-13(2,3)17-11(18)7-19-12-9(14)5-8(16)6-10(12)15/h5-6H,4,7,16H2,1-3H3,(H,17,18) |
| InChIKey | KMHHWKLGZADZDL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|