C14H15BrCl3NO3 — CID 19429760
N-(1-bromo-3-methyl-2-oxopentan-3-yl)-2-(2,4,6-trichlorophenoxy)acetamide (PubChem CID 19429760) has the molecular formula C14H15BrCl3NO3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-(1-bromo-3-methyl-2-oxopentan-3-yl)-2-(2,4,6-trichlorophenoxy)acetamide.
| Compound Name | N-(1-bromo-3-methyl-2-oxopentan-3-yl)-2-(2,4,6-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19429760 |
| Molecular Formula | C14H15BrCl3NO3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | N-(1-bromo-3-methyl-2-oxopentan-3-yl)-2-(2,4,6-trichlorophenoxy)acetamide |
| SMILES | CCC(C)(NC(=O)COc1c(Cl)cc(Cl)cc1Cl)C(=O)CBr |
| InChI | InChI=1S/C14H15BrCl3NO3/c1-3-14(2,11(20)6-15)19-12(21)7-22-13-9(17)4-8(16)5-10(13)18/h4-5H,3,6-7H2,1-2H3,(H,19,21) |
| InChIKey | FCYFSMLILRRUQJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|