C10H9BrCl2N2O4 — CID 17096542
methyl N-[[2-(2-bromo-4,6-dichlorophenoxy)acetyl]amino]carbamate (PubChem CID 17096542) has the molecular formula C10H9BrCl2N2O4 and a molecular weight of 372.00 g/mol. Its IUPAC name is methyl N-[[2-(2-bromo-4,6-dichlorophenoxy)acetyl]amino]carbamate.
| Compound Name | methyl N-[[2-(2-bromo-4,6-dichlorophenoxy)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 17096542 |
| Molecular Formula | C10H9BrCl2N2O4 |
| Molecular Weight | 372.00 g/mol |
| Exact Mass | 369.91 |
| IUPAC Name | methyl N-[[2-(2-bromo-4,6-dichlorophenoxy)acetyl]amino]carbamate |
| SMILES | COC(=O)NNC(=O)COc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C10H9BrCl2N2O4/c1-18-10(17)15-14-8(16)4-19-9-6(11)2-5(12)3-7(9)13/h2-3H,4H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | JSKVLPCNNVFESI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.00 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|