C22H17BrCl2N2O3 — CID 17096531
N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-2,2-diphenylacetohydrazide (PubChem CID 17096531) has the molecular formula C22H17BrCl2N2O3 and a molecular weight of 508.20 g/mol. Its IUPAC name is N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 17096531 |
| Molecular Formula | C22H17BrCl2N2O3 |
| Molecular Weight | 508.20 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(COc1c(Cl)cc(Cl)cc1Br)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17BrCl2N2O3/c23-17-11-16(24)12-18(25)21(17)30-13-19(28)26-27-22(29)20(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,20H,13H2,(H,26,28)(H,27,29) |
| InChIKey | WERYHGWSYVOKIC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.20 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|