C26H27ClN2O3 — CID 2311623
N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-2,2-diphenylacetohydrazide (PubChem CID 2311623) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 2311623 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-2,2-diphenylacetohydrazide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)C(c2ccccc2)c2ccccc2)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C26H27ClN2O3/c1-17(2)21-15-22(27)18(3)14-23(21)32-16-24(30)28-29-26(31)25(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,17,25H,16H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | OOAWNEDFDOUFEW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|