C21H21ClN2O4 — CID 31060775
2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 31060775) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is 2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 31060775 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O4/c1-11(2)15-9-17(22)12(3)7-18(15)28-10-19(25)23-13-5-6-14-16(8-13)21(27)24(4)20(14)26/h5-9,11H,10H2,1-4H3,(H,23,25) |
| InChIKey | VVTCEUPLDWTCEB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|