C19H20ClN3O5 — CID 9333373
N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-3-nitrobenzohydrazide (PubChem CID 9333373) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9333373 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N'-[2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetyl]-3-nitrobenzohydrazide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O5/c1-11(2)15-9-16(20)12(3)7-17(15)28-10-18(24)21-22-19(25)13-5-4-6-14(8-13)23(26)27/h4-9,11H,10H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | RDDYALXWWCOTOX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|