C16H13BrCl2N2O4 — CID 17095463
N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-methoxybenzohydrazide (PubChem CID 17095463) has the molecular formula C16H13BrCl2N2O4 and a molecular weight of 448.10 g/mol. Its IUPAC name is N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-methoxybenzohydrazide.
| Compound Name | N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 17095463 |
| Molecular Formula | C16H13BrCl2N2O4 |
| Molecular Weight | 448.10 g/mol |
| Exact Mass | 445.94 |
| IUPAC Name | N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)COc2c(Cl)cc(Cl)cc2Br)cc1 |
| InChI | InChI=1S/C16H13BrCl2N2O4/c1-24-11-4-2-9(3-5-11)16(23)21-20-14(22)8-25-15-12(17)6-10(18)7-13(15)19/h2-7H,8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | GRUNVWUFPQQVNA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|