C19H28ClNO5 — CID 42373924
[2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-chloro-5-methoxy-4-(2-methylpropoxy)benzoate (PubChem CID 42373924) has the molecular formula C19H28ClNO5 and a molecular weight of 385.89 g/mol. Its IUPAC name is [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-chloro-5-methoxy-4-(2-methylpropoxy)benzoate.
| Compound Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-chloro-5-methoxy-4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 42373924 |
| Molecular Formula | C19H28ClNO5 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-chloro-5-methoxy-4-(2-methylpropoxy)benzoate |
| SMILES | CCC(C)(C)NC(=O)COC(=O)c1cc(Cl)c(OCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H28ClNO5/c1-7-19(4,5)21-16(22)11-26-18(23)13-8-14(20)17(15(9-13)24-6)25-10-12(2)3/h8-9,12H,7,10-11H2,1-6H3,(H,21,22) |
| InChIKey | OLRHSXVLEJWIRX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |