C17H24BrNO5 — CID 8848079
[2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate (PubChem CID 8848079) has the molecular formula C17H24BrNO5 and a molecular weight of 402.29 g/mol. Its IUPAC name is [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 8848079 |
| Molecular Formula | C17H24BrNO5 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Br)cc(C(=O)OCC(=O)NC(C)(C)CC)cc1OC |
| InChI | InChI=1S/C17H24BrNO5/c1-6-17(3,4)19-14(20)10-24-16(21)11-8-12(18)15(23-7-2)13(9-11)22-5/h8-9H,6-7,10H2,1-5H3,(H,19,20) |
| InChIKey | JPJZMGZTVFCGOF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |