C12H16ClNO4 — CID 54931047
methyl 2-[4-(2-aminoethyl)-2-chloro-6-methoxyphenoxy]acetate (PubChem CID 54931047) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is methyl 2-[4-(2-aminoethyl)-2-chloro-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-(2-aminoethyl)-2-chloro-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 54931047 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl 2-[4-(2-aminoethyl)-2-chloro-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(CCN)cc1OC |
| InChI | InChI=1S/C12H16ClNO4/c1-16-10-6-8(3-4-14)5-9(13)12(10)18-7-11(15)17-2/h5-6H,3-4,7,14H2,1-2H3 |
| InChIKey | ILIHURDIGZDNDU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |