C11H11BrCl2O3 — CID 18620125
methyl 2-[4-(2-bromoethyl)-2,6-dichlorophenoxy]acetate (PubChem CID 18620125) has the molecular formula C11H11BrCl2O3 and a molecular weight of 342.02 g/mol. Its IUPAC name is methyl 2-[4-(2-bromoethyl)-2,6-dichlorophenoxy]acetate.
| Compound Name | methyl 2-[4-(2-bromoethyl)-2,6-dichlorophenoxy]acetate |
|---|---|
| PubChem CID | 18620125 |
| Molecular Formula | C11H11BrCl2O3 |
| Molecular Weight | 342.02 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | methyl 2-[4-(2-bromoethyl)-2,6-dichlorophenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(CCBr)cc1Cl |
| InChI | InChI=1S/C11H11BrCl2O3/c1-16-10(15)6-17-11-8(13)4-7(2-3-12)5-9(11)14/h4-5H,2-3,6H2,1H3 |
| InChIKey | MMGKFDAWAOROSZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.02 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|