C10H8F2O4 — CID 79891826
methyl 2-(2,6-difluoro-4-formylphenoxy)acetate (PubChem CID 79891826) has the molecular formula C10H8F2O4 and a molecular weight of 230.17 g/mol. Its IUPAC name is methyl 2-(2,6-difluoro-4-formylphenoxy)acetate.
| Compound Name | methyl 2-(2,6-difluoro-4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 79891826 |
| Molecular Formula | C10H8F2O4 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | methyl 2-(2,6-difluoro-4-formylphenoxy)acetate |
| SMILES | COC(=O)COc1c(F)cc(C=O)cc1F |
| InChI | InChI=1S/C10H8F2O4/c1-15-9(14)5-16-10-7(11)2-6(4-13)3-8(10)12/h2-4H,5H2,1H3 |
| InChIKey | YFNZXXUTOMFVBT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|