C18H15ClF4O8S2 — CID 161085130
methyl 2-(4-chlorosulfonyl-2,6-difluorophenoxy)acetate;methyl 2-(2,6-difluoro-4-sulfanylphenoxy)acetate (PubChem CID 161085130) has the molecular formula C18H15ClF4O8S2 and a molecular weight of 534.89 g/mol. Its IUPAC name is methyl 2-(4-chlorosulfonyl-2,6-difluorophenoxy)acetate;methyl 2-(2,6-difluoro-4-sulfanylphenoxy)acetate.
| Compound Name | methyl 2-(4-chlorosulfonyl-2,6-difluorophenoxy)acetate;methyl 2-(2,6-difluoro-4-sulfanylphenoxy)acetate |
|---|---|
| PubChem CID | 161085130 |
| Molecular Formula | C18H15ClF4O8S2 |
| Molecular Weight | 534.89 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | methyl 2-(4-chlorosulfonyl-2,6-difluorophenoxy)acetate;methyl 2-(2,6-difluoro-4-sulfanylphenoxy)acetate |
| SMILES | COC(=O)COc1c(F)cc(S(=O)(=O)Cl)cc1F.COC(=O)COc1c(F)cc(S)cc1F |
| InChI | InChI=1S/C9H7ClF2O5S.C9H8F2O3S/c1-16-8(13)4-17-9-6(11)2-5(3-7(9)12)18(10,14)15;1-13-8(12)4-14-9-6(10)2-5(15)3-7(9)11/h2-3H,4H2,1H3;2-3,15H,4H2,1H3 |
| InChIKey | UGKFUZDNFKAROM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.89 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|