C9H7ClF2O5S — CID 81268857
3-(4-chlorosulfonyl-2,6-difluorophenoxy)propanoic acid (PubChem CID 81268857) has the molecular formula C9H7ClF2O5S and a molecular weight of 300.67 g/mol. Its IUPAC name is 3-(4-chlorosulfonyl-2,6-difluorophenoxy)propanoic acid.
| Compound Name | 3-(4-chlorosulfonyl-2,6-difluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 81268857 |
| Molecular Formula | C9H7ClF2O5S |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 3-(4-chlorosulfonyl-2,6-difluorophenoxy)propanoic acid |
| SMILES | O=C(O)CCOc1c(F)cc(S(=O)(=O)Cl)cc1F |
| InChI | InChI=1S/C9H7ClF2O5S/c10-18(15,16)5-3-6(11)9(7(12)4-5)17-2-1-8(13)14/h3-4H,1-2H2,(H,13,14) |
| InChIKey | PAKCAUNRPIMCGI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |