C10H10ClFO5S — CID 166000122
3-(5-chlorosulfonyl-3-fluoro-2-methoxyphenyl)propanoic acid (PubChem CID 166000122) has the molecular formula C10H10ClFO5S and a molecular weight of 296.70 g/mol. Its IUPAC name is 3-(5-chlorosulfonyl-3-fluoro-2-methoxyphenyl)propanoic acid.
| Compound Name | 3-(5-chlorosulfonyl-3-fluoro-2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 166000122 |
| Molecular Formula | C10H10ClFO5S |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 3-(5-chlorosulfonyl-3-fluoro-2-methoxyphenyl)propanoic acid |
| SMILES | COc1c(F)cc(S(=O)(=O)Cl)cc1CCC(=O)O |
| InChI | InChI=1S/C10H10ClFO5S/c1-17-10-6(2-3-9(13)14)4-7(5-8(10)12)18(11,15)16/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | GCQAUCPZOJATJL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |