3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid

C10H9BrF2O3 — CID 117475612

IUPAC3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid
SMILESCOc1c(F)c(Br)cc(CCC(=O)O)c1F
InChIInChI=1S/C10H9BrF2O3/c1-16-10-8(12)5(2-3-7(14)15)4-6(11)9(10)13/h4H,2-3H2,1H3,(H,14,15)
InChIKeySNLRYPPGFAXBLU-UHFFFAOYSA-N
MW295.08 g/mol
LogP2.75
Rot. Bonds4

About 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid

3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid (PubChem CID 117475612) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid
PubChem CID117475612
Molecular FormulaC10H9BrF2O3
Molecular Weight295.08 g/mol
Exact Mass293.97
IUPAC Name3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid
SMILESCOc1c(F)c(Br)cc(CCC(=O)O)c1F
InChIInChI=1S/C10H9BrF2O3/c1-16-10-8(12)5(2-3-7(14)15)4-6(11)9(10)13/h4H,2-3H2,1H3,(H,14,15)
InChIKeySNLRYPPGFAXBLU-UHFFFAOYSA-N
XLogP2.75
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.08
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid?
The IUPAC name of 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid (CID 117475612) is 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid.
What is the SMILES notation for 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid?
The canonical SMILES for 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid is COc1c(F)c(Br)cc(CCC(=O)O)c1F.
What is the InChIKey of 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid?
The InChIKey is SNLRYPPGFAXBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O3/c1-16-10-8(12)5(2-3-7(14)15)4-6(11)9(10)13/h4H,2-3H2,1H3,(H,14,15).
What are the key properties of 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid?
3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid has a molecular weight of 295.08 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-2,4-difluoro-3-methoxyphenyl)propanoic acid is sourced from PubChem (CID 117475612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).