C12H15ClF2O3S — CID 82927491
4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride (PubChem CID 82927491) has the molecular formula C12H15ClF2O3S and a molecular weight of 312.77 g/mol. Its IUPAC name is 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride.
| Compound Name | 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82927491 |
| Molecular Formula | C12H15ClF2O3S |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride |
| SMILES | CCC(CC)COc1c(F)cc(S(=O)(=O)Cl)cc1F |
| InChI | InChI=1S/C12H15ClF2O3S/c1-3-8(4-2)7-18-12-10(14)5-9(6-11(12)15)19(13,16)17/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | MWLADQRMPJIHBO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |