4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride

C12H15ClF2O3S — CID 82927491

IUPAC4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride
SMILESCCC(CC)COc1c(F)cc(S(=O)(=O)Cl)cc1F
InChIInChI=1S/C12H15ClF2O3S/c1-3-8(4-2)7-18-12-10(14)5-9(6-11(12)15)19(13,16)17/h5-6,8H,3-4,7H2,1-2H3
InChIKeyMWLADQRMPJIHBO-UHFFFAOYSA-N
MW312.77 g/mol
LogP3.71
Rot. Bonds6

About 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride

4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride (PubChem CID 82927491) has the molecular formula C12H15ClF2O3S and a molecular weight of 312.77 g/mol. Its IUPAC name is 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride
PubChem CID82927491
Molecular FormulaC12H15ClF2O3S
Molecular Weight312.77 g/mol
Exact Mass312.04
IUPAC Name4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride
SMILESCCC(CC)COc1c(F)cc(S(=O)(=O)Cl)cc1F
InChIInChI=1S/C12H15ClF2O3S/c1-3-8(4-2)7-18-12-10(14)5-9(6-11(12)15)19(13,16)17/h5-6,8H,3-4,7H2,1-2H3
InChIKeyMWLADQRMPJIHBO-UHFFFAOYSA-N
XLogP3.71
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.77
LogP ≤ 53.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride?
The IUPAC name of 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride (CID 82927491) is 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride.
What is the SMILES notation for 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride?
The canonical SMILES for 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride is CCC(CC)COc1c(F)cc(S(=O)(=O)Cl)cc1F.
What is the InChIKey of 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride?
The InChIKey is MWLADQRMPJIHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF2O3S/c1-3-8(4-2)7-18-12-10(14)5-9(6-11(12)15)19(13,16)17/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride?
4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride has a molecular weight of 312.77 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylbutoxy)-3,5-difluorobenzenesulfonyl chloride is sourced from PubChem (CID 82927491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).