C12H16Cl2O3S — CID 82925747
3-chloro-4-(2-ethylbutoxy)benzenesulfonyl chloride (PubChem CID 82925747) has the molecular formula C12H16Cl2O3S and a molecular weight of 311.23 g/mol. Its IUPAC name is 3-chloro-4-(2-ethylbutoxy)benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-(2-ethylbutoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82925747 |
| Molecular Formula | C12H16Cl2O3S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-chloro-4-(2-ethylbutoxy)benzenesulfonyl chloride |
| SMILES | CCC(CC)COc1ccc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2O3S/c1-3-9(4-2)8-17-12-6-5-10(7-11(12)13)18(14,15)16/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | XXEIEWJVPLJNJY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |