C13H17ClO5S — CID 43123552
5-(4-chlorosulfonyl-2,6-dimethylphenoxy)pentanoic acid (PubChem CID 43123552) has the molecular formula C13H17ClO5S and a molecular weight of 320.79 g/mol. Its IUPAC name is 5-(4-chlorosulfonyl-2,6-dimethylphenoxy)pentanoic acid.
| Compound Name | 5-(4-chlorosulfonyl-2,6-dimethylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 43123552 |
| Molecular Formula | C13H17ClO5S |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-(4-chlorosulfonyl-2,6-dimethylphenoxy)pentanoic acid |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(C)c1OCCCCC(=O)O |
| InChI | InChI=1S/C13H17ClO5S/c1-9-7-11(20(14,17)18)8-10(2)13(9)19-6-4-3-5-12(15)16/h7-8H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | PBEMSEUBIYYVKS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|