C13H20ClNO3S — CID 114525006
4-[3-(dimethylamino)propoxy]-3,5-dimethylbenzenesulfonyl chloride (PubChem CID 114525006) has the molecular formula C13H20ClNO3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propoxy]-3,5-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-[3-(dimethylamino)propoxy]-3,5-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 114525006 |
| Molecular Formula | C13H20ClNO3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[3-(dimethylamino)propoxy]-3,5-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(C)c1OCCCN(C)C |
| InChI | InChI=1S/C13H20ClNO3S/c1-10-8-12(19(14,16)17)9-11(2)13(10)18-7-5-6-15(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | IJJQNASFFXJFOJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|