C14H22ClNO5 — CID 106988428
1-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106988428) has the molecular formula C14H22ClNO5 and a molecular weight of 319.79 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106988428 |
| Molecular Formula | C14H22ClNO5 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[4-(aminomethyl)-2-chloro-6-methoxyphenoxy]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)COc1c(Cl)cc(CN)cc1OC |
| InChI | InChI=1S/C14H22ClNO5/c1-18-3-4-20-8-11(17)9-21-14-12(15)5-10(7-16)6-13(14)19-2/h5-6,11,17H,3-4,7-9,16H2,1-2H3 |
| InChIKey | ASSGKGKWXVTUSH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|