C13H19ClO5 — CID 106991077
1-[2-chloro-4-(hydroxymethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106991077) has the molecular formula C13H19ClO5 and a molecular weight of 290.74 g/mol. Its IUPAC name is 1-[2-chloro-4-(hydroxymethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[2-chloro-4-(hydroxymethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106991077 |
| Molecular Formula | C13H19ClO5 |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-[2-chloro-4-(hydroxymethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)COc1ccc(CO)cc1Cl |
| InChI | InChI=1S/C13H19ClO5/c1-17-4-5-18-8-11(16)9-19-13-3-2-10(7-15)6-12(13)14/h2-3,6,11,15-16H,4-5,7-9H2,1H3 |
| InChIKey | GORWCTTVCKYLLX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|