C14H21ClO4 — CID 107263397
1-butoxy-3-[2-chloro-4-(hydroxymethyl)phenoxy]propan-2-ol (PubChem CID 107263397) has the molecular formula C14H21ClO4 and a molecular weight of 288.77 g/mol. Its IUPAC name is 1-butoxy-3-[2-chloro-4-(hydroxymethyl)phenoxy]propan-2-ol.
| Compound Name | 1-butoxy-3-[2-chloro-4-(hydroxymethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 107263397 |
| Molecular Formula | C14H21ClO4 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-butoxy-3-[2-chloro-4-(hydroxymethyl)phenoxy]propan-2-ol |
| SMILES | CCCCOCC(O)COc1ccc(CO)cc1Cl |
| InChI | InChI=1S/C14H21ClO4/c1-2-3-6-18-9-12(17)10-19-14-5-4-11(8-16)7-13(14)15/h4-5,7,12,16-17H,2-3,6,8-10H2,1H3 |
| InChIKey | PXGHFLRQXSWJEP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|