C14H22BrNO4 — CID 106988607
1-[2-bromo-4-(methylaminomethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106988607) has the molecular formula C14H22BrNO4 and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-[2-bromo-4-(methylaminomethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[2-bromo-4-(methylaminomethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106988607 |
| Molecular Formula | C14H22BrNO4 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-[2-bromo-4-(methylaminomethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | CNCc1ccc(OCC(O)COCCOC)c(Br)c1 |
| InChI | InChI=1S/C14H22BrNO4/c1-16-8-11-3-4-14(13(15)7-11)20-10-12(17)9-19-6-5-18-2/h3-4,7,12,16-17H,5-6,8-10H2,1-2H3 |
| InChIKey | FXOQWTQPWXRMGG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|