C14H21BrN2O3 — CID 63045317
2-[2-bromo-4-(methylaminomethyl)phenoxy]-N-(3-methoxypropyl)acetamide (PubChem CID 63045317) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-[2-bromo-4-(methylaminomethyl)phenoxy]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[2-bromo-4-(methylaminomethyl)phenoxy]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 63045317 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[2-bromo-4-(methylaminomethyl)phenoxy]-N-(3-methoxypropyl)acetamide |
| SMILES | CNCc1ccc(OCC(=O)NCCCOC)c(Br)c1 |
| InChI | InChI=1S/C14H21BrN2O3/c1-16-9-11-4-5-13(12(15)8-11)20-10-14(18)17-6-3-7-19-2/h4-5,8,16H,3,6-7,9-10H2,1-2H3,(H,17,18) |
| InChIKey | ACFAFTXLIFPUOX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|