C14H21FO5 — CID 106991174
1-[2-fluoro-4-(1-hydroxyethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106991174) has the molecular formula C14H21FO5 and a molecular weight of 288.32 g/mol. Its IUPAC name is 1-[2-fluoro-4-(1-hydroxyethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[2-fluoro-4-(1-hydroxyethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106991174 |
| Molecular Formula | C14H21FO5 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[2-fluoro-4-(1-hydroxyethyl)phenoxy]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)COc1ccc(C(C)O)cc1F |
| InChI | InChI=1S/C14H21FO5/c1-10(16)11-3-4-14(13(15)7-11)20-9-12(17)8-19-6-5-18-2/h3-4,7,10,12,16-17H,5-6,8-9H2,1-2H3 |
| InChIKey | PWHYTEAAXPCPDO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|