C15H23FO2 — CID 114200314
1-[4-(2,4-dimethylpentoxy)-3-fluorophenyl]ethanol (PubChem CID 114200314) has the molecular formula C15H23FO2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylpentoxy)-3-fluorophenyl]ethanol.
| Compound Name | 1-[4-(2,4-dimethylpentoxy)-3-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 114200314 |
| Molecular Formula | C15H23FO2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-[4-(2,4-dimethylpentoxy)-3-fluorophenyl]ethanol |
| SMILES | CC(C)CC(C)COc1ccc(C(C)O)cc1F |
| InChI | InChI=1S/C15H23FO2/c1-10(2)7-11(3)9-18-15-6-5-13(12(4)17)8-14(15)16/h5-6,8,10-12,17H,7,9H2,1-4H3 |
| InChIKey | BWBNGPUGHXLFHW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |