C14H21NO5 — CID 112978341
2-(2,3-dimethoxyphenoxy)-N-(3-methoxypropyl)acetamide (PubChem CID 112978341) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenoxy)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(2,3-dimethoxyphenoxy)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 112978341 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(2,3-dimethoxyphenoxy)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)COc1cccc(OC)c1OC |
| InChI | InChI=1S/C14H21NO5/c1-17-9-5-8-15-13(16)10-20-12-7-4-6-11(18-2)14(12)19-3/h4,6-7H,5,8-10H2,1-3H3,(H,15,16) |
| InChIKey | FYPKESCDXOLBQD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|