C11H16N2O4 — CID 116820693
2-(2,3-dimethoxyphenoxy)-N'-methylacetohydrazide (PubChem CID 116820693) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenoxy)-N'-methylacetohydrazide.
| Compound Name | 2-(2,3-dimethoxyphenoxy)-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 116820693 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(2,3-dimethoxyphenoxy)-N'-methylacetohydrazide |
| SMILES | CNNC(=O)COc1cccc(OC)c1OC |
| InChI | InChI=1S/C11H16N2O4/c1-12-13-10(14)7-17-9-6-4-5-8(15-2)11(9)16-3/h4-6,12H,7H2,1-3H3,(H,13,14) |
| InChIKey | GIBGZVVRCOIDLB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|