About 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide
2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide (PubChem CID 116846802) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide.
Molecular Properties
| Compound Name | 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide |
| PubChem CID | 116846802 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide |
| SMILES | CNNC(=O)COCc1ccccc1OC |
| InChI | InChI=1S/C11H16N2O3/c1-12-13-11(14)8-16-7-9-5-3-4-6-10(9)15-2/h3-6,12H,7-8H2,1-2H3,(H,13,14) |
| InChIKey | PPUHLWUOAODGNY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide?
The IUPAC name of 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide (CID 116846802) is 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide.
What is the SMILES notation for 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide?
The canonical SMILES for 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide is CNNC(=O)COCc1ccccc1OC.
What is the InChIKey of 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide?
The InChIKey is PPUHLWUOAODGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-12-13-11(14)8-16-7-9-5-3-4-6-10(9)15-2/h3-6,12H,7-8H2,1-2H3,(H,13,14).
What are the key properties of 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide?
2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide has a molecular weight of 224.26 g/mol, XLogP of 0.46, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methoxyphenyl)methoxy]-N'-methylacetohydrazide is sourced from PubChem (CID 116846802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).