C12H18N2O2 — CID 116846195
2-(3-ethyl-4-methoxyphenyl)-N'-methylacetohydrazide (PubChem CID 116846195) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(3-ethyl-4-methoxyphenyl)-N'-methylacetohydrazide.
| Compound Name | 2-(3-ethyl-4-methoxyphenyl)-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 116846195 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(3-ethyl-4-methoxyphenyl)-N'-methylacetohydrazide |
| SMILES | CCc1cc(CC(=O)NNC)ccc1OC |
| InChI | InChI=1S/C12H18N2O2/c1-4-10-7-9(5-6-11(10)16-3)8-12(15)14-13-2/h5-7,13H,4,8H2,1-3H3,(H,14,15) |
| InChIKey | WPDXGJQIVGOWAF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|