3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid

C16H16O4 — CID 54308818

IUPAC3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid
SMILESCOc1cccc(-c2c(C)cc(C(=O)O)cc2OC)c1
InChIInChI=1S/C16H16O4/c1-10-7-12(16(17)18)9-14(20-3)15(10)11-5-4-6-13(8-11)19-2/h4-9H,1-3H3,(H,17,18)
InChIKeySJLABNYQWDYUQC-UHFFFAOYSA-N
MW272.30 g/mol
LogP3.38
Rot. Bonds4

About 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid

3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid (PubChem CID 54308818) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid.

Molecular Properties

Compound Name3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid
PubChem CID54308818
Molecular FormulaC16H16O4
Molecular Weight272.30 g/mol
Exact Mass272.10
IUPAC Name3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid
SMILESCOc1cccc(-c2c(C)cc(C(=O)O)cc2OC)c1
InChIInChI=1S/C16H16O4/c1-10-7-12(16(17)18)9-14(20-3)15(10)11-5-4-6-13(8-11)19-2/h4-9H,1-3H3,(H,17,18)
InChIKeySJLABNYQWDYUQC-UHFFFAOYSA-N
XLogP3.38
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.30
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-methoxy-4-(4-methoxyphenyl)-5-methylbenzoic acid
CID 54447835
3-methoxy-2-(3-methoxyphenyl)benzoic acid
CID 19594928
3-chloro-5-(3-methoxyphenyl)benzoic acid
CID 53225426
3-fluoro-5-(3-methoxyphenyl)-4-methylbenzoic acid
CID 176508636
2-(3-methoxyphenyl)-1,3,5-trimethylbenzene
CID 66916575
3-(3-methoxy-4-methylphenyl)benzoic acid
CID 53216637
3-(2,6-difluorophenyl)-5-methoxybenzoic acid
CID 53225965
6-(3-methoxyphenoxy)-5-methylpyridine-3-carboxylic acid
CID 80631293
4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid
CID 16768707
1-[3-methoxy-4-(3-methoxyphenyl)phenyl]ethanone
CID 20716225
3-methoxy-5-(2-methyl-5-phenylphenyl)benzoic acid
CID 57248171
2-(3-methoxyphenyl)-3-methylbenzonitrile
CID 172915337

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid?
The IUPAC name of 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid (CID 54308818) is 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid.
What is the SMILES notation for 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid?
The canonical SMILES for 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid is COc1cccc(-c2c(C)cc(C(=O)O)cc2OC)c1.
What is the InChIKey of 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid?
The InChIKey is SJLABNYQWDYUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4/c1-10-7-12(16(17)18)9-14(20-3)15(10)11-5-4-6-13(8-11)19-2/h4-9H,1-3H3,(H,17,18).
What are the key properties of 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid?
3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid has a molecular weight of 272.30 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-(3-methoxyphenyl)-5-methylbenzoic acid is sourced from PubChem (CID 54308818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).