C15H12ClFO2 — CID 106882164
2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid (PubChem CID 106882164) has the molecular formula C15H12ClFO2 and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid.
| Compound Name | 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 106882164 |
| Molecular Formula | C15H12ClFO2 |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid |
| SMILES | Cc1cc(C)c(-c2ccc(Cl)c(C(=O)O)c2)c(F)c1 |
| InChI | InChI=1S/C15H12ClFO2/c1-8-5-9(2)14(13(17)6-8)10-3-4-12(16)11(7-10)15(18)19/h3-7H,1-2H3,(H,18,19) |
| InChIKey | PYZXPDUDJMFCJD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |