2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid

C15H12ClFO2 — CID 106882164

IUPAC2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid
SMILESCc1cc(C)c(-c2ccc(Cl)c(C(=O)O)c2)c(F)c1
InChIInChI=1S/C15H12ClFO2/c1-8-5-9(2)14(13(17)6-8)10-3-4-12(16)11(7-10)15(18)19/h3-7H,1-2H3,(H,18,19)
InChIKeyPYZXPDUDJMFCJD-UHFFFAOYSA-N
MW278.71 g/mol
LogP4.46
Rot. Bonds2

About 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid

2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid (PubChem CID 106882164) has the molecular formula C15H12ClFO2 and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid.

Molecular Properties

Compound Name2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid
PubChem CID106882164
Molecular FormulaC15H12ClFO2
Molecular Weight278.71 g/mol
Exact Mass278.05
IUPAC Name2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid
SMILESCc1cc(C)c(-c2ccc(Cl)c(C(=O)O)c2)c(F)c1
InChIInChI=1S/C15H12ClFO2/c1-8-5-9(2)14(13(17)6-8)10-3-4-12(16)11(7-10)15(18)19/h3-7H,1-2H3,(H,18,19)
InChIKeyPYZXPDUDJMFCJD-UHFFFAOYSA-N
XLogP4.46
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.71
LogP ≤ 54.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid?
The IUPAC name of 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid (CID 106882164) is 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid.
What is the SMILES notation for 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid?
The canonical SMILES for 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid is Cc1cc(C)c(-c2ccc(Cl)c(C(=O)O)c2)c(F)c1.
What is the InChIKey of 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid?
The InChIKey is PYZXPDUDJMFCJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClFO2/c1-8-5-9(2)14(13(17)6-8)10-3-4-12(16)11(7-10)15(18)19/h3-7H,1-2H3,(H,18,19).
What are the key properties of 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid?
2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid has a molecular weight of 278.71 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(2-fluoro-4,6-dimethylphenyl)benzoic acid is sourced from PubChem (CID 106882164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).