C15H13FO2 — CID 106882157
4-(2-fluoro-4,6-dimethylphenyl)benzoic acid (PubChem CID 106882157) has the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 4-(2-fluoro-4,6-dimethylphenyl)benzoic acid.
| Compound Name | 4-(2-fluoro-4,6-dimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 106882157 |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-(2-fluoro-4,6-dimethylphenyl)benzoic acid |
| SMILES | Cc1cc(C)c(-c2ccc(C(=O)O)cc2)c(F)c1 |
| InChI | InChI=1S/C15H13FO2/c1-9-7-10(2)14(13(16)8-9)11-3-5-12(6-4-11)15(17)18/h3-8H,1-2H3,(H,17,18) |
| InChIKey | NMFPNMLIWAXQQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |