C12HF9O — CID 2783336
2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenol (PubChem CID 2783336) has the molecular formula C12HF9O and a molecular weight of 332.12 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenol.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenol |
|---|---|
| PubChem CID | 2783336 |
| Molecular Formula | C12HF9O |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenol |
| SMILES | Oc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12HF9O/c13-3-1(4(14)8(18)9(19)7(3)17)2-5(15)10(20)12(22)11(21)6(2)16/h22H |
| InChIKey | MLXJPZBMOLLESC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|