C6F4 — CID 45090416
2,3,4,6-tetrafluorobicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 45090416) has the molecular formula C6F4 and a molecular weight of 148.06 g/mol. Its IUPAC name is 2,3,4,6-tetrafluorobicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 2,3,4,6-tetrafluorobicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 45090416 |
| Molecular Formula | C6F4 |
| Molecular Weight | 148.06 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | 2,3,4,6-tetrafluorobicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | Fc1c(F)c2c(F)c-2c1F |
| InChI | InChI=1S/C6F4/c7-3-1-2(3)5(9)6(10)4(1)8 |
| InChIKey | VKQYYVJBPVLXQS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.06 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|