C28F18 — CID 151112358
1,2,3,4,5,6,7,9,10-nonafluoro-8-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrene (PubChem CID 151112358) has the molecular formula C28F18 and a molecular weight of 678.27 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,9,10-nonafluoro-8-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrene.
| Compound Name | 1,2,3,4,5,6,7,9,10-nonafluoro-8-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrene |
|---|---|
| PubChem CID | 151112358 |
| Molecular Formula | C28F18 |
| Molecular Weight | 678.27 g/mol |
| Exact Mass | 677.97 |
| IUPAC Name | 1,2,3,4,5,6,7,9,10-nonafluoro-8-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrene |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c3c(F)c(F)c4c(F)c(F)c(F)c5c(F)c(F)c2c3c45)c(F)c1F |
| InChI | InChI=1S/C28F18/c29-11-3-1-2-8(16(11)34)19(37)23(41)20(38)9(2)18(36)17(35)7(1)15(33)12(30)4(3)5-6(14(32)25(43)24(42)13(5)31)10-21(39)26(44)28(46)27(45)22(10)40 |
| InChIKey | MQKGOMFHKUMURQ-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.27 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|