C20F10 — CID 58827575
2,3,5,6,8,9,11,12,19,20-decafluorohexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4,6,8,10,12,14,16,19-decaene (PubChem CID 58827575) has the molecular formula C20F10 and a molecular weight of 430.20 g/mol. Its IUPAC name is 2,3,5,6,8,9,11,12,19,20-decafluorohexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4,6,8,10,12,14,16,19-decaene.
| Compound Name | 2,3,5,6,8,9,11,12,19,20-decafluorohexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4,6,8,10,12,14,16,19-decaene |
|---|---|
| PubChem CID | 58827575 |
| Molecular Formula | C20F10 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 2,3,5,6,8,9,11,12,19,20-decafluorohexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4,6,8,10,12,14,16,19-decaene |
| SMILES | Fc1c(F)c2c(F)c(F)c3c(F)c(F)c4c(F)c(F)c5c(F)c(F)c1c1c2c3c4c51 |
| InChI | InChI=1S/C20F10/c21-11-6-1-2-4-5-3(1)8(14(24)12(6)22)16(26)18(28)10(5)20(30)19(29)9(4)17(27)15(25)7(2)13(11)23 |
| InChIKey | PDGUTNHKEKCBKH-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|