C14Br2F8 — CID 91225361
9,10-dibromo-1,2,3,4,5,6,7,8-octafluoroanthracene (PubChem CID 91225361) has the molecular formula C14Br2F8 and a molecular weight of 479.95 g/mol. Its IUPAC name is 9,10-dibromo-1,2,3,4,5,6,7,8-octafluoroanthracene.
| Compound Name | 9,10-dibromo-1,2,3,4,5,6,7,8-octafluoroanthracene |
|---|---|
| PubChem CID | 91225361 |
| Molecular Formula | C14Br2F8 |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 477.82 |
| IUPAC Name | 9,10-dibromo-1,2,3,4,5,6,7,8-octafluoroanthracene |
| SMILES | Fc1c(F)c(F)c2c(Br)c3c(F)c(F)c(F)c(F)c3c(Br)c2c1F |
| InChI | InChI=1S/C14Br2F8/c15-5-1-2(8(18)12(22)11(21)7(1)17)6(16)4-3(5)9(19)13(23)14(24)10(4)20 |
| InChIKey | MKWBNLRPDXHELO-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|