About CID 87457293
CID 87457293 (PubChem CID 87457293) has the molecular formula C6BrF5Mg
and a molecular weight of 271.26 g/mol.
Molecular Properties
| Compound Name | CID 87457293 |
| PubChem CID | 87457293 |
| Molecular Formula | C6BrF5Mg |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c(Br)c(F)c1F.[Mg] |
| InChI | InChI=1S/C6BrF5.Mg/c7-1-2(8)4(10)6(12)5(11)3(1)9; |
| InChIKey | NTHREYPJFCBZLI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87457293 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87457293?
The IUPAC name of CID 87457293 (CID 87457293) is not available.
What is the SMILES notation for CID 87457293?
The canonical SMILES for CID 87457293 is Fc1c(F)c(F)c(Br)c(F)c1F.[Mg].
What is the InChIKey of CID 87457293?
The InChIKey is NTHREYPJFCBZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6BrF5.Mg/c7-1-2(8)4(10)6(12)5(11)3(1)9;.
What are the key properties of CID 87457293?
CID 87457293 has a molecular weight of 271.26 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87457293 is sourced from PubChem (CID 87457293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).