C6HBr3F2O — CID 86243413
2,3,4-tribromo-5,6-difluorophenol (PubChem CID 86243413) has the molecular formula C6HBr3F2O and a molecular weight of 366.78 g/mol. Its IUPAC name is 2,3,4-tribromo-5,6-difluorophenol.
| Compound Name | 2,3,4-tribromo-5,6-difluorophenol |
|---|---|
| PubChem CID | 86243413 |
| Molecular Formula | C6HBr3F2O |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 363.75 |
| IUPAC Name | 2,3,4-tribromo-5,6-difluorophenol |
| SMILES | Oc1c(F)c(F)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C6HBr3F2O/c7-1-2(8)4(10)5(11)6(12)3(1)9/h12H |
| InChIKey | FRLIVDUOAVDWGE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|