C14HBrF9N — CID 23269805
2-(4-bromo-2,3,5,6-tetrafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile (PubChem CID 23269805) has the molecular formula C14HBrF9N and a molecular weight of 434.06 g/mol. Its IUPAC name is 2-(4-bromo-2,3,5,6-tetrafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile.
| Compound Name | 2-(4-bromo-2,3,5,6-tetrafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23269805 |
| Molecular Formula | C14HBrF9N |
| Molecular Weight | 434.06 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 2-(4-bromo-2,3,5,6-tetrafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
| SMILES | N#CC(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C14HBrF9N/c15-5-10(20)6(16)3(7(17)11(5)21)2(1-25)4-8(18)12(22)14(24)13(23)9(4)19/h2H |
| InChIKey | NGOSYCDORDOQPQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.06 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|