C7BrClF6O — CID 75365424
1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene (PubChem CID 75365424) has the molecular formula C7BrClF6O and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 75365424 |
| Molecular Formula | C7BrClF6O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 327.87 |
| IUPAC Name | 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(OC(F)(F)Cl)c(F)c(F)c1Br |
| InChI | InChI=1S/C7BrClF6O/c8-1-2(10)4(12)6(5(13)3(1)11)16-7(9,14)15 |
| InChIKey | KMMVDKNLVSFSBB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|