About 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene
1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene (PubChem CID 75365424) has the molecular formula C7BrClF6O
and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene |
| PubChem CID | 75365424 |
| Molecular Formula | C7BrClF6O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 327.87 |
| IUPAC Name | 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(OC(F)(F)Cl)c(F)c(F)c1Br |
| InChI | InChI=1S/C7BrClF6O/c8-1-2(10)4(12)6(5(13)3(1)11)16-7(9,14)15 |
| InChIKey | KMMVDKNLVSFSBB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene?
The IUPAC name of 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene (CID 75365424) is 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene.
What is the SMILES notation for 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene?
The canonical SMILES for 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene is Fc1c(F)c(OC(F)(F)Cl)c(F)c(F)c1Br.
What is the InChIKey of 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene?
The InChIKey is KMMVDKNLVSFSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7BrClF6O/c8-1-2(10)4(12)6(5(13)3(1)11)16-7(9,14)15.
What are the key properties of 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene?
1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene has a molecular weight of 329.42 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[chloro(difluoro)methoxy]-2,3,5,6-tetrafluorobenzene is sourced from PubChem (CID 75365424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).